C18H20ClFN2O6 — CID 11915311
[(2S)-1-(2-chloro-4-fluoroanilino)-1-oxopropan-2-yl] 2-[(1S,2R,3S)-3-methyl-2-(nitromethyl)-5-oxocyclopentyl]acetate (PubChem CID 11915311) has the molecular formula C18H20ClFN2O6 and a molecular weight of 414.82 g/mol. Its IUPAC name is [(2S)-1-(2-chloro-4-fluoroanilino)-1-oxopropan-2-yl] 2-[(1S,2R,3S)-3-methyl-2-(nitromethyl)-5-oxocyclopentyl]acetate.
| Compound Name | [(2S)-1-(2-chloro-4-fluoroanilino)-1-oxopropan-2-yl] 2-[(1S,2R,3S)-3-methyl-2-(nitromethyl)-5-oxocyclopentyl]acetate |
|---|---|
| PubChem CID | 11915311 |
| Molecular Formula | C18H20ClFN2O6 |
| Molecular Weight | 414.82 g/mol |
| Exact Mass | 414.10 |
| IUPAC Name | [(2S)-1-(2-chloro-4-fluoroanilino)-1-oxopropan-2-yl] 2-[(1S,2R,3S)-3-methyl-2-(nitromethyl)-5-oxocyclopentyl]acetate |
| SMILES | C[C@H](OC(=O)C[C@@H]1C(=O)C[C@H](C)[C@H]1C[N+](=O)[O-])C(=O)Nc1ccc(F)cc1Cl |
| InChI | InChI=1S/C18H20ClFN2O6/c1-9-5-16(23)12(13(9)8-22(26)27)7-17(24)28-10(2)18(25)21-15-4-3-11(20)6-14(15)19/h3-4,6,9-10,12-13H,5,7-8H2,1-2H3,(H,21,25)/t9-,10-,12-,13+/m0/s1 |
| InChIKey | PSEUCSJAQKHPTC-XRRVDJEJSA-N |
| XLogP | 2.86 |
| TPSA | 115.61 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 414.82 |
| LogP ≤ 5 | 2.86 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|