C23H30FN3O2 — CID 8971994
(2S)-N-ethyl-2-[4-[(5-fluoro-2-methoxyphenyl)methyl]piperazin-1-yl]-N-phenylpropanamide (PubChem CID 8971994) has the molecular formula C23H30FN3O2 and a molecular weight of 399.51 g/mol. Its IUPAC name is (2S)-N-ethyl-2-[4-[(5-fluoro-2-methoxyphenyl)methyl]piperazin-1-yl]-N-phenylpropanamide.
| Compound Name | (2S)-N-ethyl-2-[4-[(5-fluoro-2-methoxyphenyl)methyl]piperazin-1-yl]-N-phenylpropanamide |
|---|---|
| PubChem CID | 8971994 |
| Molecular Formula | C23H30FN3O2 |
| Molecular Weight | 399.51 g/mol |
| Exact Mass | 399.23 |
| IUPAC Name | (2S)-N-ethyl-2-[4-[(5-fluoro-2-methoxyphenyl)methyl]piperazin-1-yl]-N-phenylpropanamide |
| SMILES | CCN(C(=O)[C@H](C)N1CCN(Cc2cc(F)ccc2OC)CC1)c1ccccc1 |
| InChI | InChI=1S/C23H30FN3O2/c1-4-27(21-8-6-5-7-9-21)23(28)18(2)26-14-12-25(13-15-26)17-19-16-20(24)10-11-22(19)29-3/h5-11,16,18H,4,12-15,17H2,1-3H3/t18-/m0/s1 |
| InChIKey | NRCCLADZZAKFDS-SFHVURJKSA-N |
| XLogP | 3.39 |
| TPSA | 36.02 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 399.51 |
| LogP ≤ 5 | 3.39 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |