C18H28N6OS — CID 8977346
N-[3-(tert-butylamino)propyl]-2-[1-(3,4-dimethylphenyl)tetrazol-5-yl]sulfanylacetamide (PubChem CID 8977346) has the molecular formula C18H28N6OS and a molecular weight of 376.53 g/mol. Its IUPAC name is N-[3-(tert-butylamino)propyl]-2-[1-(3,4-dimethylphenyl)tetrazol-5-yl]sulfanylacetamide.
| Compound Name | N-[3-(tert-butylamino)propyl]-2-[1-(3,4-dimethylphenyl)tetrazol-5-yl]sulfanylacetamide |
|---|---|
| PubChem CID | 8977346 |
| Molecular Formula | C18H28N6OS |
| Molecular Weight | 376.53 g/mol |
| Exact Mass | 376.20 |
| IUPAC Name | N-[3-(tert-butylamino)propyl]-2-[1-(3,4-dimethylphenyl)tetrazol-5-yl]sulfanylacetamide |
| SMILES | Cc1ccc(-n2nnnc2SCC(=O)NCCCNC(C)(C)C)cc1C |
| InChI | InChI=1S/C18H28N6OS/c1-13-7-8-15(11-14(13)2)24-17(21-22-23-24)26-12-16(25)19-9-6-10-20-18(3,4)5/h7-8,11,20H,6,9-10,12H2,1-5H3,(H,19,25) |
| InChIKey | USJQWQGDCZSUDH-UHFFFAOYSA-N |
| XLogP | 2.27 |
| TPSA | 84.73 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 376.53 |
| LogP ≤ 5 | 2.27 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|