C19H31N6OS+ — CID 8804385
tert-butyl-[3-[[2-[1-(4-propan-2-ylphenyl)tetrazol-5-yl]sulfanylacetyl]amino]propyl]azanium (PubChem CID 8804385) has the molecular formula C19H31N6OS+ and a molecular weight of 391.57 g/mol. Its IUPAC name is tert-butyl-[3-[[2-[1-(4-propan-2-ylphenyl)tetrazol-5-yl]sulfanylacetyl]amino]propyl]azanium.
| Compound Name | tert-butyl-[3-[[2-[1-(4-propan-2-ylphenyl)tetrazol-5-yl]sulfanylacetyl]amino]propyl]azanium |
|---|---|
| PubChem CID | 8804385 |
| Molecular Formula | C19H31N6OS+ |
| Molecular Weight | 391.57 g/mol |
| Exact Mass | 391.23 |
| IUPAC Name | tert-butyl-[3-[[2-[1-(4-propan-2-ylphenyl)tetrazol-5-yl]sulfanylacetyl]amino]propyl]azanium |
| SMILES | CC(C)c1ccc(-n2nnnc2SCC(=O)NCCC[NH2+]C(C)(C)C)cc1 |
| InChI | InChI=1S/C19H30N6OS/c1-14(2)15-7-9-16(10-8-15)25-18(22-23-24-25)27-13-17(26)20-11-6-12-21-19(3,4)5/h7-10,14,21H,6,11-13H2,1-5H3,(H,20,26)/p+1 |
| InChIKey | SDVGWCMAAQSSOD-UHFFFAOYSA-O |
| XLogP | 1.75 |
| TPSA | 89.31 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 391.57 |
| LogP ≤ 5 | 1.75 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|