C12H10ClFN2OS — CID 897735
(E)-3-(2-chloro-6-fluorophenyl)-N-(4,5-dihydro-1,3-thiazol-2-yl)prop-2-enamide (PubChem CID 897735) has the molecular formula C12H10ClFN2OS and a molecular weight of 284.74 g/mol. Its IUPAC name is (E)-3-(2-chloro-6-fluorophenyl)-N-(4,5-dihydro-1,3-thiazol-2-yl)prop-2-enamide.
| Compound Name | (E)-3-(2-chloro-6-fluorophenyl)-N-(4,5-dihydro-1,3-thiazol-2-yl)prop-2-enamide |
|---|---|
| PubChem CID | 897735 |
| Molecular Formula | C12H10ClFN2OS |
| Molecular Weight | 284.74 g/mol |
| Exact Mass | 284.02 |
| IUPAC Name | (E)-3-(2-chloro-6-fluorophenyl)-N-(4,5-dihydro-1,3-thiazol-2-yl)prop-2-enamide |
| SMILES | O=C(/C=C/c1c(F)cccc1Cl)NC1=NCCS1 |
| InChI | InChI=1S/C12H10ClFN2OS/c13-9-2-1-3-10(14)8(9)4-5-11(17)16-12-15-6-7-18-12/h1-5H,6-7H2,(H,15,16,17)/b5-4+ |
| InChIKey | IDKLQWQTMSORRA-SNAWJCMRSA-N |
| XLogP | 2.71 |
| TPSA | 41.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 284.74 |
| LogP ≤ 5 | 2.71 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|