C22H24N4O2 — CID 8980999
(2S)-N-[(Z)-(1-benzylpyrazol-4-yl)methylideneamino]-2-(2,3-dimethylphenoxy)propanamide (PubChem CID 8980999) has the molecular formula C22H24N4O2 and a molecular weight of 376.46 g/mol. Its IUPAC name is (2S)-N-[(Z)-(1-benzylpyrazol-4-yl)methylideneamino]-2-(2,3-dimethylphenoxy)propanamide.
| Compound Name | (2S)-N-[(Z)-(1-benzylpyrazol-4-yl)methylideneamino]-2-(2,3-dimethylphenoxy)propanamide |
|---|---|
| PubChem CID | 8980999 |
| Molecular Formula | C22H24N4O2 |
| Molecular Weight | 376.46 g/mol |
| Exact Mass | 376.19 |
| IUPAC Name | (2S)-N-[(Z)-(1-benzylpyrazol-4-yl)methylideneamino]-2-(2,3-dimethylphenoxy)propanamide |
| SMILES | Cc1cccc(O[C@@H](C)C(=O)N/N=C\c2cnn(Cc3ccccc3)c2)c1C |
| InChI | InChI=1S/C22H24N4O2/c1-16-8-7-11-21(17(16)2)28-18(3)22(27)25-23-12-20-13-24-26(15-20)14-19-9-5-4-6-10-19/h4-13,15,18H,14H2,1-3H3,(H,25,27)/b23-12-/t18-/m0/s1 |
| InChIKey | MGBMNGWNIZZAKU-NVIPHDJISA-N |
| XLogP | 3.47 |
| TPSA | 68.51 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 376.46 |
| LogP ≤ 5 | 3.47 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|