C22H24N4O3 — CID 8981368
N-[(Z)-(1-benzylpyrazol-4-yl)methylideneamino]-3-methoxy-4-propoxybenzamide (PubChem CID 8981368) has the molecular formula C22H24N4O3 and a molecular weight of 392.46 g/mol. Its IUPAC name is N-[(Z)-(1-benzylpyrazol-4-yl)methylideneamino]-3-methoxy-4-propoxybenzamide.
| Compound Name | N-[(Z)-(1-benzylpyrazol-4-yl)methylideneamino]-3-methoxy-4-propoxybenzamide |
|---|---|
| PubChem CID | 8981368 |
| Molecular Formula | C22H24N4O3 |
| Molecular Weight | 392.46 g/mol |
| Exact Mass | 392.18 |
| IUPAC Name | N-[(Z)-(1-benzylpyrazol-4-yl)methylideneamino]-3-methoxy-4-propoxybenzamide |
| SMILES | CCCOc1ccc(C(=O)N/N=C\c2cnn(Cc3ccccc3)c2)cc1OC |
| InChI | InChI=1S/C22H24N4O3/c1-3-11-29-20-10-9-19(12-21(20)28-2)22(27)25-23-13-18-14-24-26(16-18)15-17-7-5-4-6-8-17/h4-10,12-14,16H,3,11,15H2,1-2H3,(H,25,27)/b23-13- |
| InChIKey | UUSIMXBSQYPBFZ-QRVIBDJDSA-N |
| XLogP | 3.49 |
| TPSA | 77.74 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 392.46 |
| LogP ≤ 5 | 3.49 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|