C19H28N2O6S — CID 8983500
[(2R)-1-(2-methoxyethylamino)-1-oxopropan-2-yl] 4-(4-methylpiperidin-1-yl)sulfonylbenzoate (PubChem CID 8983500) has the molecular formula C19H28N2O6S and a molecular weight of 412.51 g/mol. Its IUPAC name is [(2R)-1-(2-methoxyethylamino)-1-oxopropan-2-yl] 4-(4-methylpiperidin-1-yl)sulfonylbenzoate.
| Compound Name | [(2R)-1-(2-methoxyethylamino)-1-oxopropan-2-yl] 4-(4-methylpiperidin-1-yl)sulfonylbenzoate |
|---|---|
| PubChem CID | 8983500 |
| Molecular Formula | C19H28N2O6S |
| Molecular Weight | 412.51 g/mol |
| Exact Mass | 412.17 |
| IUPAC Name | [(2R)-1-(2-methoxyethylamino)-1-oxopropan-2-yl] 4-(4-methylpiperidin-1-yl)sulfonylbenzoate |
| SMILES | COCCNC(=O)[C@@H](C)OC(=O)c1ccc(S(=O)(=O)N2CCC(C)CC2)cc1 |
| InChI | InChI=1S/C19H28N2O6S/c1-14-8-11-21(12-9-14)28(24,25)17-6-4-16(5-7-17)19(23)27-15(2)18(22)20-10-13-26-3/h4-7,14-15H,8-13H2,1-3H3,(H,20,22)/t15-/m1/s1 |
| InChIKey | GLZUWFPDNRFJBU-OAHLLOKOSA-N |
| XLogP | 1.42 |
| TPSA | 102.01 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 412.51 |
| LogP ≤ 5 | 1.42 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|