About [(2R)-1-(2,5-difluoroanilino)-1-oxopropan-2-yl] 2-(2-oxo-1-pyridinyl)acetate
[(2R)-1-(2,5-difluoroanilino)-1-oxopropan-2-yl] 2-(2-oxo-1-pyridinyl)acetate (PubChem CID 8987469) has the molecular formula C16H14F2N2O4
and a molecular weight of 336.29 g/mol. Its IUPAC name is [(2R)-1-(2,5-difluoroanilino)-1-oxopropan-2-yl] 2-(2-oxo-1-pyridinyl)acetate.
Molecular Properties
| Compound Name | [(2R)-1-(2,5-difluoroanilino)-1-oxopropan-2-yl] 2-(2-oxo-1-pyridinyl)acetate |
| PubChem CID | 8987469 |
| Molecular Formula | C16H14F2N2O4 |
| Molecular Weight | 336.29 g/mol |
| Exact Mass | 336.09 |
| IUPAC Name | [(2R)-1-(2,5-difluoroanilino)-1-oxopropan-2-yl] 2-(2-oxo-1-pyridinyl)acetate |
| SMILES | C[C@@H](OC(=O)Cn1ccccc1=O)C(=O)Nc1cc(F)ccc1F |
| InChI | InChI=1S/C16H14F2N2O4/c1-10(16(23)19-13-8-11(17)5-6-12(13)18)24-15(22)9-20-7-3-2-4-14(20)21/h2-8,10H,9H2,1H3,(H,19,23)/t10-/m1/s1 |
| InChIKey | VJGHIOCENDBGNY-SNVBAGLBSA-N |
| XLogP | 1.70 |
| TPSA | 77.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 336.29 |
| LogP ≤ 5 | 1.70 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze [(2R)-1-(2,5-difluoroanilino)-1-oxopropan-2-yl] 2-(2-oxo-1-pyridinyl)acetate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [(2R)-1-(2,5-difluoroanilino)-1-oxopropan-2-yl] 2-(2-oxo-1-pyridinyl)acetate?
The IUPAC name of [(2R)-1-(2,5-difluoroanilino)-1-oxopropan-2-yl] 2-(2-oxo-1-pyridinyl)acetate (CID 8987469) is [(2R)-1-(2,5-difluoroanilino)-1-oxopropan-2-yl] 2-(2-oxo-1-pyridinyl)acetate.
What is the SMILES notation for [(2R)-1-(2,5-difluoroanilino)-1-oxopropan-2-yl] 2-(2-oxo-1-pyridinyl)acetate?
The canonical SMILES for [(2R)-1-(2,5-difluoroanilino)-1-oxopropan-2-yl] 2-(2-oxo-1-pyridinyl)acetate is C[C@@H](OC(=O)Cn1ccccc1=O)C(=O)Nc1cc(F)ccc1F.
What is the InChIKey of [(2R)-1-(2,5-difluoroanilino)-1-oxopropan-2-yl] 2-(2-oxo-1-pyridinyl)acetate?
The InChIKey is VJGHIOCENDBGNY-SNVBAGLBSA-N. The full InChI is InChI=1S/C16H14F2N2O4/c1-10(16(23)19-13-8-11(17)5-6-12(13)18)24-15(22)9-20-7-3-2-4-14(20)21/h2-8,10H,9H2,1H3,(H,19,23)/t10-/m1/s1.
What are the key properties of [(2R)-1-(2,5-difluoroanilino)-1-oxopropan-2-yl] 2-(2-oxo-1-pyridinyl)acetate?
[(2R)-1-(2,5-difluoroanilino)-1-oxopropan-2-yl] 2-(2-oxo-1-pyridinyl)acetate has a molecular weight of 336.29 g/mol, XLogP of 1.70, 5 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for [(2R)-1-(2,5-difluoroanilino)-1-oxopropan-2-yl] 2-(2-oxo-1-pyridinyl)acetate is sourced from PubChem (CID 8987469), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).