C18H15N5O5 — CID 8990852
N-[2-[[5-(3-nitrophenyl)furan-2-carbonyl]amino]ethyl]pyrazine-2-carboxamide (PubChem CID 8990852) has the molecular formula C18H15N5O5 and a molecular weight of 381.35 g/mol. Its IUPAC name is N-[2-[[5-(3-nitrophenyl)furan-2-carbonyl]amino]ethyl]pyrazine-2-carboxamide.
| Compound Name | N-[2-[[5-(3-nitrophenyl)furan-2-carbonyl]amino]ethyl]pyrazine-2-carboxamide |
|---|---|
| PubChem CID | 8990852 |
| Molecular Formula | C18H15N5O5 |
| Molecular Weight | 381.35 g/mol |
| Exact Mass | 381.11 |
| IUPAC Name | N-[2-[[5-(3-nitrophenyl)furan-2-carbonyl]amino]ethyl]pyrazine-2-carboxamide |
| SMILES | O=C(NCCNC(=O)c1ccc(-c2cccc([N+](=O)[O-])c2)o1)c1cnccn1 |
| InChI | InChI=1S/C18H15N5O5/c24-17(14-11-19-6-7-20-14)21-8-9-22-18(25)16-5-4-15(28-16)12-2-1-3-13(10-12)23(26)27/h1-7,10-11H,8-9H2,(H,21,24)(H,22,25) |
| InChIKey | CRLZHCLMUMMVKK-UHFFFAOYSA-N |
| XLogP | 1.80 |
| TPSA | 140.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 381.35 |
| LogP ≤ 5 | 1.80 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|