C17H19NO2S — CID 899095
N-[(4-phenyloxan-4-yl)methyl]thiophene-2-carboxamide (PubChem CID 899095) has the molecular formula C17H19NO2S and a molecular weight of 301.41 g/mol. Its IUPAC name is N-[(4-phenyloxan-4-yl)methyl]thiophene-2-carboxamide.
| Compound Name | N-[(4-phenyloxan-4-yl)methyl]thiophene-2-carboxamide |
|---|---|
| PubChem CID | 899095 |
| Molecular Formula | C17H19NO2S |
| Molecular Weight | 301.41 g/mol |
| Exact Mass | 301.11 |
| IUPAC Name | N-[(4-phenyloxan-4-yl)methyl]thiophene-2-carboxamide |
| SMILES | O=C(NCC1(c2ccccc2)CCOCC1)c1cccs1 |
| InChI | InChI=1S/C17H19NO2S/c19-16(15-7-4-12-21-15)18-13-17(8-10-20-11-9-17)14-5-2-1-3-6-14/h1-7,12H,8-11,13H2,(H,18,19) |
| InChIKey | ZYEKNHITTHNGEQ-UHFFFAOYSA-N |
| XLogP | 3.23 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 301.41 |
| LogP ≤ 5 | 3.23 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |