C19H17FN2O5S — CID 8991326
N-[2-[(4S)-2,3-dioxo-4-phenylpyrrolidin-1-yl]-2-oxoethyl]-N-(3-fluorophenyl)methanesulfonamide (PubChem CID 8991326) has the molecular formula C19H17FN2O5S and a molecular weight of 404.42 g/mol. Its IUPAC name is N-[2-[(4S)-2,3-dioxo-4-phenylpyrrolidin-1-yl]-2-oxoethyl]-N-(3-fluorophenyl)methanesulfonamide.
| Compound Name | N-[2-[(4S)-2,3-dioxo-4-phenylpyrrolidin-1-yl]-2-oxoethyl]-N-(3-fluorophenyl)methanesulfonamide |
|---|---|
| PubChem CID | 8991326 |
| Molecular Formula | C19H17FN2O5S |
| Molecular Weight | 404.42 g/mol |
| Exact Mass | 404.08 |
| IUPAC Name | N-[2-[(4S)-2,3-dioxo-4-phenylpyrrolidin-1-yl]-2-oxoethyl]-N-(3-fluorophenyl)methanesulfonamide |
| SMILES | CS(=O)(=O)N(CC(=O)N1C[C@H](c2ccccc2)C(=O)C1=O)c1cccc(F)c1 |
| InChI | InChI=1S/C19H17FN2O5S/c1-28(26,27)22(15-9-5-8-14(20)10-15)12-17(23)21-11-16(18(24)19(21)25)13-6-3-2-4-7-13/h2-10,16H,11-12H2,1H3/t16-/m1/s1 |
| InChIKey | CLGVGROKWMUNNN-MRXNPFEDSA-N |
| XLogP | 1.31 |
| TPSA | 91.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 404.42 |
| LogP ≤ 5 | 1.31 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|