C22H25F3N2O3 — CID 8993216
(2S)-2-(6,7-diethoxy-3,4-dihydro-1H-isoquinolin-2-yl)-N-(2,3,4-trifluorophenyl)propanamide (PubChem CID 8993216) has the molecular formula C22H25F3N2O3 and a molecular weight of 422.45 g/mol. Its IUPAC name is (2S)-2-(6,7-diethoxy-3,4-dihydro-1H-isoquinolin-2-yl)-N-(2,3,4-trifluorophenyl)propanamide.
| Compound Name | (2S)-2-(6,7-diethoxy-3,4-dihydro-1H-isoquinolin-2-yl)-N-(2,3,4-trifluorophenyl)propanamide |
|---|---|
| PubChem CID | 8993216 |
| Molecular Formula | C22H25F3N2O3 |
| Molecular Weight | 422.45 g/mol |
| Exact Mass | 422.18 |
| IUPAC Name | (2S)-2-(6,7-diethoxy-3,4-dihydro-1H-isoquinolin-2-yl)-N-(2,3,4-trifluorophenyl)propanamide |
| SMILES | CCOc1cc2c(cc1OCC)CN([C@@H](C)C(=O)Nc1ccc(F)c(F)c1F)CC2 |
| InChI | InChI=1S/C22H25F3N2O3/c1-4-29-18-10-14-8-9-27(12-15(14)11-19(18)30-5-2)13(3)22(28)26-17-7-6-16(23)20(24)21(17)25/h6-7,10-11,13H,4-5,8-9,12H2,1-3H3,(H,26,28)/t13-/m0/s1 |
| InChIKey | WJLJBQUUFPAMMR-ZDUSSCGKSA-N |
| XLogP | 4.29 |
| TPSA | 50.80 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 422.45 |
| LogP ≤ 5 | 4.29 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|