C20H30N4O2+2 — CID 8994010
2-[4-[(5-methyl-1,2-oxazol-3-yl)methyl]piperazine-1,4-diium-1-yl]-N-(3-phenylpropyl)acetamide (PubChem CID 8994010) has the molecular formula C20H30N4O2+2 and a molecular weight of 358.49 g/mol. Its IUPAC name is 2-[4-[(5-methyl-1,2-oxazol-3-yl)methyl]piperazine-1,4-diium-1-yl]-N-(3-phenylpropyl)acetamide.
| Compound Name | 2-[4-[(5-methyl-1,2-oxazol-3-yl)methyl]piperazine-1,4-diium-1-yl]-N-(3-phenylpropyl)acetamide |
|---|---|
| PubChem CID | 8994010 |
| Molecular Formula | C20H30N4O2+2 |
| Molecular Weight | 358.49 g/mol |
| Exact Mass | 358.24 |
| IUPAC Name | 2-[4-[(5-methyl-1,2-oxazol-3-yl)methyl]piperazine-1,4-diium-1-yl]-N-(3-phenylpropyl)acetamide |
| SMILES | Cc1cc(C[NH+]2CC[NH+](CC(=O)NCCCc3ccccc3)CC2)no1 |
| InChI | InChI=1S/C20H28N4O2/c1-17-14-19(22-26-17)15-23-10-12-24(13-11-23)16-20(25)21-9-5-8-18-6-3-2-4-7-18/h2-4,6-7,14H,5,8-13,15-16H2,1H3,(H,21,25)/p+2 |
| InChIKey | DBDZEOVZFFGHGP-UHFFFAOYSA-P |
| XLogP | -0.98 |
| TPSA | 64.01 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 358.49 |
| LogP ≤ 5 | -0.98 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|