C21H33N3O2 — CID 8997511
(2S)-N-cyclopentyl-2-[4-[(2-methoxy-5-methylphenyl)methyl]piperazin-1-yl]propanamide (PubChem CID 8997511) has the molecular formula C21H33N3O2 and a molecular weight of 359.51 g/mol. Its IUPAC name is (2S)-N-cyclopentyl-2-[4-[(2-methoxy-5-methylphenyl)methyl]piperazin-1-yl]propanamide.
| Compound Name | (2S)-N-cyclopentyl-2-[4-[(2-methoxy-5-methylphenyl)methyl]piperazin-1-yl]propanamide |
|---|---|
| PubChem CID | 8997511 |
| Molecular Formula | C21H33N3O2 |
| Molecular Weight | 359.51 g/mol |
| Exact Mass | 359.26 |
| IUPAC Name | (2S)-N-cyclopentyl-2-[4-[(2-methoxy-5-methylphenyl)methyl]piperazin-1-yl]propanamide |
| SMILES | COc1ccc(C)cc1CN1CCN([C@@H](C)C(=O)NC2CCCC2)CC1 |
| InChI | InChI=1S/C21H33N3O2/c1-16-8-9-20(26-3)18(14-16)15-23-10-12-24(13-11-23)17(2)21(25)22-19-6-4-5-7-19/h8-9,14,17,19H,4-7,10-13,15H2,1-3H3,(H,22,25)/t17-/m0/s1 |
| InChIKey | FRVMULZFBVPIIX-KRWDZBQOSA-N |
| XLogP | 2.57 |
| TPSA | 44.81 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 359.51 |
| LogP ≤ 5 | 2.57 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |