C20H31N3O — CID 9266173
(2R)-N-cyclopentyl-2-[4-[(3-methylphenyl)methyl]piperazin-1-yl]propanamide (PubChem CID 9266173) has the molecular formula C20H31N3O and a molecular weight of 329.49 g/mol. Its IUPAC name is (2R)-N-cyclopentyl-2-[4-[(3-methylphenyl)methyl]piperazin-1-yl]propanamide.
| Compound Name | (2R)-N-cyclopentyl-2-[4-[(3-methylphenyl)methyl]piperazin-1-yl]propanamide |
|---|---|
| PubChem CID | 9266173 |
| Molecular Formula | C20H31N3O |
| Molecular Weight | 329.49 g/mol |
| Exact Mass | 329.25 |
| IUPAC Name | (2R)-N-cyclopentyl-2-[4-[(3-methylphenyl)methyl]piperazin-1-yl]propanamide |
| SMILES | Cc1cccc(CN2CCN([C@H](C)C(=O)NC3CCCC3)CC2)c1 |
| InChI | InChI=1S/C20H31N3O/c1-16-6-5-7-18(14-16)15-22-10-12-23(13-11-22)17(2)20(24)21-19-8-3-4-9-19/h5-7,14,17,19H,3-4,8-13,15H2,1-2H3,(H,21,24)/t17-/m1/s1 |
| InChIKey | KCTFQPXIYXOCPW-QGZVFWFLSA-N |
| XLogP | 2.56 |
| TPSA | 35.58 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 329.49 |
| LogP ≤ 5 | 2.56 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |