C17H23N2OS+ — CID 8998181
[(2R)-1-amino-1-oxopropan-2-yl]-[(S)-(4-propan-2-ylphenyl)-thiophen-2-ylmethyl]azanium (PubChem CID 8998181) has the molecular formula C17H23N2OS+ and a molecular weight of 303.45 g/mol. Its IUPAC name is [(2R)-1-amino-1-oxopropan-2-yl]-[(S)-(4-propan-2-ylphenyl)-thiophen-2-ylmethyl]azanium.
| Compound Name | [(2R)-1-amino-1-oxopropan-2-yl]-[(S)-(4-propan-2-ylphenyl)-thiophen-2-ylmethyl]azanium |
|---|---|
| PubChem CID | 8998181 |
| Molecular Formula | C17H23N2OS+ |
| Molecular Weight | 303.45 g/mol |
| Exact Mass | 303.15 |
| IUPAC Name | [(2R)-1-amino-1-oxopropan-2-yl]-[(S)-(4-propan-2-ylphenyl)-thiophen-2-ylmethyl]azanium |
| SMILES | CC(C)c1ccc([C@H]([NH2+][C@H](C)C(N)=O)c2cccs2)cc1 |
| InChI | InChI=1S/C17H22N2OS/c1-11(2)13-6-8-14(9-7-13)16(15-5-4-10-21-15)19-12(3)17(18)20/h4-12,16,19H,1-3H3,(H2,18,20)/p+1/t12-,16+/m1/s1 |
| InChIKey | ORTNIHRBUJJTGE-WBMJQRKESA-O |
| XLogP | 2.40 |
| TPSA | 59.70 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 303.45 |
| LogP ≤ 5 | 2.40 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |