C24H30N4O3 — CID 8998488
(1S)-1-(4-butylphenyl)-2-methyl-N-[(1R)-1-[5-(4-nitrophenyl)-1,3,4-oxadiazol-2-yl]ethyl]propan-1-amine (PubChem CID 8998488) has the molecular formula C24H30N4O3 and a molecular weight of 422.53 g/mol. Its IUPAC name is (1S)-1-(4-butylphenyl)-2-methyl-N-[(1R)-1-[5-(4-nitrophenyl)-1,3,4-oxadiazol-2-yl]ethyl]propan-1-amine.
| Compound Name | (1S)-1-(4-butylphenyl)-2-methyl-N-[(1R)-1-[5-(4-nitrophenyl)-1,3,4-oxadiazol-2-yl]ethyl]propan-1-amine |
|---|---|
| PubChem CID | 8998488 |
| Molecular Formula | C24H30N4O3 |
| Molecular Weight | 422.53 g/mol |
| Exact Mass | 422.23 |
| IUPAC Name | (1S)-1-(4-butylphenyl)-2-methyl-N-[(1R)-1-[5-(4-nitrophenyl)-1,3,4-oxadiazol-2-yl]ethyl]propan-1-amine |
| SMILES | CCCCc1ccc([C@@H](N[C@H](C)c2nnc(-c3ccc([N+](=O)[O-])cc3)o2)C(C)C)cc1 |
| InChI | InChI=1S/C24H30N4O3/c1-5-6-7-18-8-10-19(11-9-18)22(16(2)3)25-17(4)23-26-27-24(31-23)20-12-14-21(15-13-20)28(29)30/h8-17,22,25H,5-7H2,1-4H3/t17-,22+/m1/s1 |
| InChIKey | DZHHTZCMDIBWCE-VGSWGCGISA-N |
| XLogP | 6.04 |
| TPSA | 94.09 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 422.53 |
| LogP ≤ 5 | 6.04 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|