C24H31N4O3+ — CID 8996140
[(1R)-2-methyl-1-[4-(2-methylpropyl)phenyl]propyl]-[(1S)-1-[5-(4-nitrophenyl)-1,3,4-oxadiazol-2-yl]ethyl]azanium (PubChem CID 8996140) has the molecular formula C24H31N4O3+ and a molecular weight of 423.54 g/mol. Its IUPAC name is [(1R)-2-methyl-1-[4-(2-methylpropyl)phenyl]propyl]-[(1S)-1-[5-(4-nitrophenyl)-1,3,4-oxadiazol-2-yl]ethyl]azanium.
| Compound Name | [(1R)-2-methyl-1-[4-(2-methylpropyl)phenyl]propyl]-[(1S)-1-[5-(4-nitrophenyl)-1,3,4-oxadiazol-2-yl]ethyl]azanium |
|---|---|
| PubChem CID | 8996140 |
| Molecular Formula | C24H31N4O3+ |
| Molecular Weight | 423.54 g/mol |
| Exact Mass | 423.24 |
| IUPAC Name | [(1R)-2-methyl-1-[4-(2-methylpropyl)phenyl]propyl]-[(1S)-1-[5-(4-nitrophenyl)-1,3,4-oxadiazol-2-yl]ethyl]azanium |
| SMILES | CC(C)Cc1ccc([C@H]([NH2+][C@@H](C)c2nnc(-c3ccc([N+](=O)[O-])cc3)o2)C(C)C)cc1 |
| InChI | InChI=1S/C24H30N4O3/c1-15(2)14-18-6-8-19(9-7-18)22(16(3)4)25-17(5)23-26-27-24(31-23)20-10-12-21(13-11-20)28(29)30/h6-13,15-17,22,25H,14H2,1-5H3/p+1/t17-,22+/m0/s1 |
| InChIKey | MPZUNLQABXUWBS-HTAPYJJXSA-O |
| XLogP | 4.86 |
| TPSA | 98.67 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 423.54 |
| LogP ≤ 5 | 4.86 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|