C21H25N4O5+ — CID 8681850
2-(3,4-dimethoxyphenyl)ethyl-methyl-[(1S)-1-[5-(4-nitrophenyl)-1,3,4-oxadiazol-2-yl]ethyl]azanium (PubChem CID 8681850) has the molecular formula C21H25N4O5+ and a molecular weight of 413.45 g/mol. Its IUPAC name is 2-(3,4-dimethoxyphenyl)ethyl-methyl-[(1S)-1-[5-(4-nitrophenyl)-1,3,4-oxadiazol-2-yl]ethyl]azanium.
| Compound Name | 2-(3,4-dimethoxyphenyl)ethyl-methyl-[(1S)-1-[5-(4-nitrophenyl)-1,3,4-oxadiazol-2-yl]ethyl]azanium |
|---|---|
| PubChem CID | 8681850 |
| Molecular Formula | C21H25N4O5+ |
| Molecular Weight | 413.45 g/mol |
| Exact Mass | 413.18 |
| IUPAC Name | 2-(3,4-dimethoxyphenyl)ethyl-methyl-[(1S)-1-[5-(4-nitrophenyl)-1,3,4-oxadiazol-2-yl]ethyl]azanium |
| SMILES | COc1ccc(CC[NH+](C)[C@@H](C)c2nnc(-c3ccc([N+](=O)[O-])cc3)o2)cc1OC |
| InChI | InChI=1S/C21H24N4O5/c1-14(24(2)12-11-15-5-10-18(28-3)19(13-15)29-4)20-22-23-21(30-20)16-6-8-17(9-7-16)25(26)27/h5-10,13-14H,11-12H2,1-4H3/p+1/t14-/m0/s1 |
| InChIKey | GKJWMRSIMPNCAF-AWEZNQCLSA-O |
| XLogP | 2.48 |
| TPSA | 104.96 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 413.45 |
| LogP ≤ 5 | 2.48 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|