C22H26N5O4+ — CID 8622135
methyl-[(1R)-1-[5-(4-nitrophenyl)-1,3,4-oxadiazol-2-yl]ethyl]-[2-oxo-2-(2,4,6-trimethylanilino)ethyl]azanium (PubChem CID 8622135) has the molecular formula C22H26N5O4+ and a molecular weight of 424.48 g/mol. Its IUPAC name is methyl-[(1R)-1-[5-(4-nitrophenyl)-1,3,4-oxadiazol-2-yl]ethyl]-[2-oxo-2-(2,4,6-trimethylanilino)ethyl]azanium.
| Compound Name | methyl-[(1R)-1-[5-(4-nitrophenyl)-1,3,4-oxadiazol-2-yl]ethyl]-[2-oxo-2-(2,4,6-trimethylanilino)ethyl]azanium |
|---|---|
| PubChem CID | 8622135 |
| Molecular Formula | C22H26N5O4+ |
| Molecular Weight | 424.48 g/mol |
| Exact Mass | 424.20 |
| IUPAC Name | methyl-[(1R)-1-[5-(4-nitrophenyl)-1,3,4-oxadiazol-2-yl]ethyl]-[2-oxo-2-(2,4,6-trimethylanilino)ethyl]azanium |
| SMILES | Cc1cc(C)c(NC(=O)C[NH+](C)[C@H](C)c2nnc(-c3ccc([N+](=O)[O-])cc3)o2)c(C)c1 |
| InChI | InChI=1S/C22H25N5O4/c1-13-10-14(2)20(15(3)11-13)23-19(28)12-26(5)16(4)21-24-25-22(31-21)17-6-8-18(9-7-17)27(29)30/h6-11,16H,12H2,1-5H3,(H,23,28)/p+1/t16-/m1/s1 |
| InChIKey | BBUAQWWXGWGSQN-MRXNPFEDSA-O |
| XLogP | 2.78 |
| TPSA | 115.60 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 424.48 |
| LogP ≤ 5 | 2.78 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|