C20H23N4O3+ — CID 8695671
(2,4-dimethylphenyl)methyl-methyl-[(1R)-1-[5-(4-nitrophenyl)-1,3,4-oxadiazol-2-yl]ethyl]azanium (PubChem CID 8695671) has the molecular formula C20H23N4O3+ and a molecular weight of 367.43 g/mol. Its IUPAC name is (2,4-dimethylphenyl)methyl-methyl-[(1R)-1-[5-(4-nitrophenyl)-1,3,4-oxadiazol-2-yl]ethyl]azanium.
| Compound Name | (2,4-dimethylphenyl)methyl-methyl-[(1R)-1-[5-(4-nitrophenyl)-1,3,4-oxadiazol-2-yl]ethyl]azanium |
|---|---|
| PubChem CID | 8695671 |
| Molecular Formula | C20H23N4O3+ |
| Molecular Weight | 367.43 g/mol |
| Exact Mass | 367.18 |
| IUPAC Name | (2,4-dimethylphenyl)methyl-methyl-[(1R)-1-[5-(4-nitrophenyl)-1,3,4-oxadiazol-2-yl]ethyl]azanium |
| SMILES | Cc1ccc(C[NH+](C)[C@H](C)c2nnc(-c3ccc([N+](=O)[O-])cc3)o2)c(C)c1 |
| InChI | InChI=1S/C20H22N4O3/c1-13-5-6-17(14(2)11-13)12-23(4)15(3)19-21-22-20(27-19)16-7-9-18(10-8-16)24(25)26/h5-11,15H,12H2,1-4H3/p+1/t15-/m1/s1 |
| InChIKey | UDJGARLWLOHTCA-OAHLLOKOSA-O |
| XLogP | 3.04 |
| TPSA | 86.50 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 367.43 |
| LogP ≤ 5 | 3.04 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|