C25H23F3N6O2 — CID 90001314
N-[3-[4-[4-[4-(trifluoromethoxy)phenyl]piperazin-1-yl]-7H-pyrrolo[2,3-d]pyrimidin-6-yl]phenyl]acetamide (PubChem CID 90001314) has the molecular formula C25H23F3N6O2 and a molecular weight of 496.49 g/mol. Its IUPAC name is N-[3-[4-[4-[4-(trifluoromethoxy)phenyl]piperazin-1-yl]-7H-pyrrolo[2,3-d]pyrimidin-6-yl]phenyl]acetamide.
| Compound Name | N-[3-[4-[4-[4-(trifluoromethoxy)phenyl]piperazin-1-yl]-7H-pyrrolo[2,3-d]pyrimidin-6-yl]phenyl]acetamide |
|---|---|
| PubChem CID | 90001314 |
| Molecular Formula | C25H23F3N6O2 |
| Molecular Weight | 496.49 g/mol |
| Exact Mass | 496.18 |
| IUPAC Name | N-[3-[4-[4-[4-(trifluoromethoxy)phenyl]piperazin-1-yl]-7H-pyrrolo[2,3-d]pyrimidin-6-yl]phenyl]acetamide |
| SMILES | CC(=O)Nc1cccc(-c2cc3c(N4CCN(c5ccc(OC(F)(F)F)cc5)CC4)ncnc3[nH]2)c1 |
| InChI | InChI=1S/C25H23F3N6O2/c1-16(35)31-18-4-2-3-17(13-18)22-14-21-23(32-22)29-15-30-24(21)34-11-9-33(10-12-34)19-5-7-20(8-6-19)36-25(26,27)28/h2-8,13-15H,9-12H2,1H3,(H,31,35)(H,29,30,32) |
| InChIKey | SHECLFWQEOFIPU-UHFFFAOYSA-N |
| XLogP | 4.81 |
| TPSA | 86.38 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 36 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 496.49 |
| LogP ≤ 5 | 4.81 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'anil_di_alk_C(246)', 'substructure': 'N/A'} |
|---|