C20H20FN3O3 — CID 90004363
5-[5-[(4-fluoropiperidin-1-yl)methyl]-1H-indol-2-yl]-6-oxo-1H-pyridine-3-carboxylic acid (PubChem CID 90004363) has the molecular formula C20H20FN3O3 and a molecular weight of 369.40 g/mol. Its IUPAC name is 5-[5-[(4-fluoropiperidin-1-yl)methyl]-1H-indol-2-yl]-6-oxo-1H-pyridine-3-carboxylic acid.
| Compound Name | 5-[5-[(4-fluoropiperidin-1-yl)methyl]-1H-indol-2-yl]-6-oxo-1H-pyridine-3-carboxylic acid |
|---|---|
| PubChem CID | 90004363 |
| Molecular Formula | C20H20FN3O3 |
| Molecular Weight | 369.40 g/mol |
| Exact Mass | 369.15 |
| IUPAC Name | 5-[5-[(4-fluoropiperidin-1-yl)methyl]-1H-indol-2-yl]-6-oxo-1H-pyridine-3-carboxylic acid |
| SMILES | O=C(O)c1c[nH]c(=O)c(-c2cc3cc(CN4CCC(F)CC4)ccc3[nH]2)c1 |
| InChI | InChI=1S/C20H20FN3O3/c21-15-3-5-24(6-4-15)11-12-1-2-17-13(7-12)9-18(23-17)16-8-14(20(26)27)10-22-19(16)25/h1-2,7-10,15,23H,3-6,11H2,(H,22,25)(H,26,27) |
| InChIKey | GPLCCNHBGHXNRT-UHFFFAOYSA-N |
| XLogP | 3.16 |
| TPSA | 89.19 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 369.40 |
| LogP ≤ 5 | 3.16 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |