C15H16FN6O2S2- — CID 90008084
CID 90008084 (PubChem CID 90008084) has the molecular formula C15H16FN6O2S2- and a molecular weight of 395.47 g/mol.
| Compound Name | CID 90008084 |
|---|---|
| PubChem CID | 90008084 |
| Molecular Formula | C15H16FN6O2S2- |
| Molecular Weight | 395.47 g/mol |
| Exact Mass | 395.08 |
| IUPAC Name | — |
| SMILES | CNc1nc(C)c(-c2nc(Nc3ccccc3)ncc2F)s1.NS(=O)[O-] |
| InChI | InChI=1S/C15H14FN5S.H3NO2S/c1-9-13(22-15(17-2)19-9)12-11(16)8-18-14(21-12)20-10-6-4-3-5-7-10;1-4(2)3/h3-8H,1-2H3,(H,17,19)(H,18,20,21);1H2,(H,2,3)/p-1 |
| InChIKey | STUIOYQJYVTJPC-UHFFFAOYSA-M |
| XLogP | 2.57 |
| TPSA | 128.88 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 395.47 |
| LogP ≤ 5 | 2.57 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'sulfinic_acid', 'substructure': 'N/A'} |
|---|