C57H63Br2N — CID 90008138
N,N-bis(3-bromophenyl)-2',7'-bis(3,7-dimethyloctan-3-yl)-9,9'-spirobi[fluorene]-4-amine (PubChem CID 90008138) has the molecular formula C57H63Br2N and a molecular weight of 921.95 g/mol. Its IUPAC name is N,N-bis(3-bromophenyl)-2',7'-bis(3,7-dimethyloctan-3-yl)-9,9'-spirobi[fluorene]-4-amine.
| Compound Name | N,N-bis(3-bromophenyl)-2',7'-bis(3,7-dimethyloctan-3-yl)-9,9'-spirobi[fluorene]-4-amine |
|---|---|
| PubChem CID | 90008138 |
| Molecular Formula | C57H63Br2N |
| Molecular Weight | 921.95 g/mol |
| Exact Mass | 919.33 |
| IUPAC Name | N,N-bis(3-bromophenyl)-2',7'-bis(3,7-dimethyloctan-3-yl)-9,9'-spirobi[fluorene]-4-amine |
| SMILES | CCC(C)(CCCC(C)C)c1ccc2c(c1)C1(c3cc(C(C)(CC)CCCC(C)C)ccc3-2)c2ccccc2-c2c(N(c3cccc(Br)c3)c3cccc(Br)c3)cccc21 |
| InChI | InChI=1S/C57H63Br2N/c1-9-55(7,32-16-18-38(3)4)40-28-30-46-47-31-29-41(56(8,10-2)33-17-19-39(5)6)35-52(47)57(51(46)34-40)49-25-12-11-24-48(49)54-50(57)26-15-27-53(54)60(44-22-13-20-42(58)36-44)45-23-14-21-43(59)37-45/h11-15,20-31,34-39H,9-10,16-19,32-33H2,1-8H3 |
| InChIKey | BAVHQADPAWAZAL-UHFFFAOYSA-N |
| XLogP | 18.01 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 60 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 921.95 |
| LogP ≤ 5 | 18.01 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |