C30H44N2O4 — CID 90009752
2-pyrrolidin-1-ylethyl N-[(3S,5R,8R,9S,10S,13R,17S)-10,13-dimethyl-17-(5-oxo-2H-furan-3-yl)-2,3,4,5,6,7,8,9,11,12,16,17-dodecahydro-1H-cyclopenta[a]phenanthren-3-yl]carbamate (PubChem CID 90009752) has the molecular formula C30H44N2O4 and a molecular weight of 496.69 g/mol. Its IUPAC name is 2-pyrrolidin-1-ylethyl N-[(3S,5R,8R,9S,10S,13R,17S)-10,13-dimethyl-17-(5-oxo-2H-furan-3-yl)-2,3,4,5,6,7,8,9,11,12,16,17-dodecahydro-1H-cyclopenta[a]phenanthren-3-yl]carbamate.
| Compound Name | 2-pyrrolidin-1-ylethyl N-[(3S,5R,8R,9S,10S,13R,17S)-10,13-dimethyl-17-(5-oxo-2H-furan-3-yl)-2,3,4,5,6,7,8,9,11,12,16,17-dodecahydro-1H-cyclopenta[a]phenanthren-3-yl]carbamate |
|---|---|
| PubChem CID | 90009752 |
| Molecular Formula | C30H44N2O4 |
| Molecular Weight | 496.69 g/mol |
| Exact Mass | 496.33 |
| IUPAC Name | 2-pyrrolidin-1-ylethyl N-[(3S,5R,8R,9S,10S,13R,17S)-10,13-dimethyl-17-(5-oxo-2H-furan-3-yl)-2,3,4,5,6,7,8,9,11,12,16,17-dodecahydro-1H-cyclopenta[a]phenanthren-3-yl]carbamate |
| SMILES | C[C@]12CC[C@H](NC(=O)OCCN3CCCC3)C[C@H]1CC[C@H]1C3=CC[C@H](C4=CC(=O)OC4)[C@@]3(C)CC[C@@H]12 |
| InChI | InChI=1S/C30H44N2O4/c1-29-11-9-22(31-28(34)35-16-15-32-13-3-4-14-32)18-21(29)5-6-23-25-8-7-24(20-17-27(33)36-19-20)30(25,2)12-10-26(23)29/h8,17,21-24,26H,3-7,9-16,18-19H2,1-2H3,(H,31,34)/t21-,22+,23+,24-,26+,29+,30-/m1/s1 |
| InChIKey | XDNQFMCEHIQVMZ-CVJSIQNJSA-N |
| XLogP | 5.24 |
| TPSA | 67.87 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 496.69 |
| LogP ≤ 5 | 5.24 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|