C26H39N3O3 — CID 90010400
1-(2-aminoethyl)-3-[(3S,5R,8R,9S,10S,13R,17S)-10,13-dimethyl-17-(5-oxo-2H-furan-3-yl)-2,3,4,5,6,7,8,9,11,12,16,17-dodecahydro-1H-cyclopenta[a]phenanthren-3-yl]urea (PubChem CID 90010400) has the molecular formula C26H39N3O3 and a molecular weight of 441.62 g/mol. Its IUPAC name is 1-(2-aminoethyl)-3-[(3S,5R,8R,9S,10S,13R,17S)-10,13-dimethyl-17-(5-oxo-2H-furan-3-yl)-2,3,4,5,6,7,8,9,11,12,16,17-dodecahydro-1H-cyclopenta[a]phenanthren-3-yl]urea.
| Compound Name | 1-(2-aminoethyl)-3-[(3S,5R,8R,9S,10S,13R,17S)-10,13-dimethyl-17-(5-oxo-2H-furan-3-yl)-2,3,4,5,6,7,8,9,11,12,16,17-dodecahydro-1H-cyclopenta[a]phenanthren-3-yl]urea |
|---|---|
| PubChem CID | 90010400 |
| Molecular Formula | C26H39N3O3 |
| Molecular Weight | 441.62 g/mol |
| Exact Mass | 441.30 |
| IUPAC Name | 1-(2-aminoethyl)-3-[(3S,5R,8R,9S,10S,13R,17S)-10,13-dimethyl-17-(5-oxo-2H-furan-3-yl)-2,3,4,5,6,7,8,9,11,12,16,17-dodecahydro-1H-cyclopenta[a]phenanthren-3-yl]urea |
| SMILES | C[C@]12CC[C@H](NC(=O)NCCN)C[C@H]1CC[C@H]1C3=CC[C@H](C4=CC(=O)OC4)[C@@]3(C)CC[C@@H]12 |
| InChI | InChI=1S/C26H39N3O3/c1-25-9-7-18(29-24(31)28-12-11-27)14-17(25)3-4-19-21-6-5-20(16-13-23(30)32-15-16)26(21,2)10-8-22(19)25/h6,13,17-20,22H,3-5,7-12,14-15,27H2,1-2H3,(H2,28,29,31)/t17-,18+,19+,20-,22+,25+,26-/m1/s1 |
| InChIKey | YCSNESLLGUCEBX-KIKWVBIZSA-N |
| XLogP | 3.68 |
| TPSA | 93.45 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 441.62 |
| LogP ≤ 5 | 3.68 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|