C25H24ClN3O3S — CID 90011949
3-chloro-N,N-diethyl-5-[4-[[(E)-3-pyridin-3-ylprop-2-enoyl]amino]phenyl]sulfinylbenzamide (PubChem CID 90011949) has the molecular formula C25H24ClN3O3S and a molecular weight of 482.01 g/mol. Its IUPAC name is 3-chloro-N,N-diethyl-5-[4-[[(E)-3-pyridin-3-ylprop-2-enoyl]amino]phenyl]sulfinylbenzamide.
| Compound Name | 3-chloro-N,N-diethyl-5-[4-[[(E)-3-pyridin-3-ylprop-2-enoyl]amino]phenyl]sulfinylbenzamide |
|---|---|
| PubChem CID | 90011949 |
| Molecular Formula | C25H24ClN3O3S |
| Molecular Weight | 482.01 g/mol |
| Exact Mass | 481.12 |
| IUPAC Name | 3-chloro-N,N-diethyl-5-[4-[[(E)-3-pyridin-3-ylprop-2-enoyl]amino]phenyl]sulfinylbenzamide |
| SMILES | CCN(CC)C(=O)c1cc(Cl)cc(S(=O)c2ccc(NC(=O)/C=C/c3cccnc3)cc2)c1 |
| InChI | InChI=1S/C25H24ClN3O3S/c1-3-29(4-2)25(31)19-14-20(26)16-23(15-19)33(32)22-10-8-21(9-11-22)28-24(30)12-7-18-6-5-13-27-17-18/h5-17H,3-4H2,1-2H3,(H,28,30)/b12-7+ |
| InChIKey | UISJTZXEXLTSSX-KPKJPENVSA-N |
| XLogP | 5.04 |
| TPSA | 79.37 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 482.01 |
| LogP ≤ 5 | 5.04 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|