C27H40N3O3Si — CID 90012286
CID 90012286 (PubChem CID 90012286) has the molecular formula C27H40N3O3Si and a molecular weight of 482.72 g/mol.
| Compound Name | CID 90012286 |
|---|---|
| PubChem CID | 90012286 |
| Molecular Formula | C27H40N3O3Si |
| Molecular Weight | 482.72 g/mol |
| Exact Mass | 482.28 |
| IUPAC Name | — |
| SMILES | C[Si](C)OC(C1Cc2ncc(NC(=O)OC(C)(C)C)cc2N(Cc2ccccc2)C1)C(C)(C)C |
| InChI | InChI=1S/C27H40N3O3Si/c1-26(2,3)24(33-34(7)8)20-14-22-23(30(18-20)17-19-12-10-9-11-13-19)15-21(16-28-22)29-25(31)32-27(4,5)6/h9-13,15-16,20,24H,14,17-18H2,1-8H3,(H,29,31) |
| InChIKey | WBJKVLBNFNPPDG-UHFFFAOYSA-N |
| XLogP | 6.29 |
| TPSA | 63.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 482.72 |
| LogP ≤ 5 | 6.29 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|