C23H30FNO4S — CID 90016060
4-(1-adamantylmethoxy)-5-cyclopropyl-N-ethylsulfonyl-2-fluorobenzamide (PubChem CID 90016060) has the molecular formula C23H30FNO4S and a molecular weight of 435.56 g/mol. Its IUPAC name is 4-(1-adamantylmethoxy)-5-cyclopropyl-N-ethylsulfonyl-2-fluorobenzamide.
| Compound Name | 4-(1-adamantylmethoxy)-5-cyclopropyl-N-ethylsulfonyl-2-fluorobenzamide |
|---|---|
| PubChem CID | 90016060 |
| Molecular Formula | C23H30FNO4S |
| Molecular Weight | 435.56 g/mol |
| Exact Mass | 435.19 |
| IUPAC Name | 4-(1-adamantylmethoxy)-5-cyclopropyl-N-ethylsulfonyl-2-fluorobenzamide |
| SMILES | CCS(=O)(=O)NC(=O)c1cc(C2CC2)c(OCC23CC4CC(CC(C4)C2)C3)cc1F |
| InChI | InChI=1S/C23H30FNO4S/c1-2-30(27,28)25-22(26)19-8-18(17-3-4-17)21(9-20(19)24)29-13-23-10-14-5-15(11-23)7-16(6-14)12-23/h8-9,14-17H,2-7,10-13H2,1H3,(H,25,26) |
| InChIKey | BQZLLEQGTIRZCM-UHFFFAOYSA-N |
| XLogP | 4.38 |
| TPSA | 72.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 435.56 |
| LogP ≤ 5 | 4.38 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |