C10H18O5 — CID 90016982
methyl 1-(2-hydroxyethyl)-3,3-dimethoxycyclobutane-1-carboxylate (PubChem CID 90016982) has the molecular formula C10H18O5 and a molecular weight of 218.25 g/mol. Its IUPAC name is methyl 1-(2-hydroxyethyl)-3,3-dimethoxycyclobutane-1-carboxylate.
| Compound Name | methyl 1-(2-hydroxyethyl)-3,3-dimethoxycyclobutane-1-carboxylate |
|---|---|
| PubChem CID | 90016982 |
| Molecular Formula | C10H18O5 |
| Molecular Weight | 218.25 g/mol |
| Exact Mass | 218.12 |
| IUPAC Name | methyl 1-(2-hydroxyethyl)-3,3-dimethoxycyclobutane-1-carboxylate |
| SMILES | COC(=O)C1(CCO)CC(OC)(OC)C1 |
| InChI | InChI=1S/C10H18O5/c1-13-8(12)9(4-5-11)6-10(7-9,14-2)15-3/h11H,4-7H2,1-3H3 |
| InChIKey | IRFQODUYBKKHBY-UHFFFAOYSA-N |
| XLogP | 0.31 |
| TPSA | 64.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 218.25 |
| LogP ≤ 5 | 0.31 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|