C19H22BrFN2O2 — CID 9001809
2-[[(1S)-1-(3-bromo-4-methoxyphenyl)ethyl]amino]-N-[2-(2-fluorophenyl)ethyl]acetamide (PubChem CID 9001809) has the molecular formula C19H22BrFN2O2 and a molecular weight of 409.30 g/mol. Its IUPAC name is 2-[[(1S)-1-(3-bromo-4-methoxyphenyl)ethyl]amino]-N-[2-(2-fluorophenyl)ethyl]acetamide.
| Compound Name | 2-[[(1S)-1-(3-bromo-4-methoxyphenyl)ethyl]amino]-N-[2-(2-fluorophenyl)ethyl]acetamide |
|---|---|
| PubChem CID | 9001809 |
| Molecular Formula | C19H22BrFN2O2 |
| Molecular Weight | 409.30 g/mol |
| Exact Mass | 408.08 |
| IUPAC Name | 2-[[(1S)-1-(3-bromo-4-methoxyphenyl)ethyl]amino]-N-[2-(2-fluorophenyl)ethyl]acetamide |
| SMILES | COc1ccc([C@H](C)NCC(=O)NCCc2ccccc2F)cc1Br |
| InChI | InChI=1S/C19H22BrFN2O2/c1-13(15-7-8-18(25-2)16(20)11-15)23-12-19(24)22-10-9-14-5-3-4-6-17(14)21/h3-8,11,13,23H,9-10,12H2,1-2H3,(H,22,24)/t13-/m0/s1 |
| InChIKey | ORQZBLLFJXDCKP-ZDUSSCGKSA-N |
| XLogP | 3.61 |
| TPSA | 50.36 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 409.30 |
| LogP ≤ 5 | 3.61 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |