About [4-(2-ethoxy-2-oxoethyl)-2,3-dihydro-1H-inden-5-yl] 3-chlorobenzoate
[4-(2-ethoxy-2-oxoethyl)-2,3-dihydro-1H-inden-5-yl] 3-chlorobenzoate (PubChem CID 90023548) has the molecular formula C20H19ClO4
and a molecular weight of 358.82 g/mol. Its IUPAC name is [4-(2-ethoxy-2-oxoethyl)-2,3-dihydro-1H-inden-5-yl] 3-chlorobenzoate.
Molecular Properties
| Compound Name | [4-(2-ethoxy-2-oxoethyl)-2,3-dihydro-1H-inden-5-yl] 3-chlorobenzoate |
| PubChem CID | 90023548 |
| Molecular Formula | C20H19ClO4 |
| Molecular Weight | 358.82 g/mol |
| Exact Mass | 358.10 |
| IUPAC Name | [4-(2-ethoxy-2-oxoethyl)-2,3-dihydro-1H-inden-5-yl] 3-chlorobenzoate |
| SMILES | CCOC(=O)Cc1c(OC(=O)c2cccc(Cl)c2)ccc2c1CCC2 |
| InChI | InChI=1S/C20H19ClO4/c1-2-24-19(22)12-17-16-8-4-5-13(16)9-10-18(17)25-20(23)14-6-3-7-15(21)11-14/h3,6-7,9-11H,2,4-5,8,12H2,1H3 |
| InChIKey | OSPLOWLHJFXDOH-UHFFFAOYSA-N |
| XLogP | 4.15 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 358.82 |
| LogP ≤ 5 | 4.15 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|
Analyze [4-(2-ethoxy-2-oxoethyl)-2,3-dihydro-1H-inden-5-yl] 3-chlorobenzoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [4-(2-ethoxy-2-oxoethyl)-2,3-dihydro-1H-inden-5-yl] 3-chlorobenzoate?
The IUPAC name of [4-(2-ethoxy-2-oxoethyl)-2,3-dihydro-1H-inden-5-yl] 3-chlorobenzoate (CID 90023548) is [4-(2-ethoxy-2-oxoethyl)-2,3-dihydro-1H-inden-5-yl] 3-chlorobenzoate.
What is the SMILES notation for [4-(2-ethoxy-2-oxoethyl)-2,3-dihydro-1H-inden-5-yl] 3-chlorobenzoate?
The canonical SMILES for [4-(2-ethoxy-2-oxoethyl)-2,3-dihydro-1H-inden-5-yl] 3-chlorobenzoate is CCOC(=O)Cc1c(OC(=O)c2cccc(Cl)c2)ccc2c1CCC2.
What is the InChIKey of [4-(2-ethoxy-2-oxoethyl)-2,3-dihydro-1H-inden-5-yl] 3-chlorobenzoate?
The InChIKey is OSPLOWLHJFXDOH-UHFFFAOYSA-N. The full InChI is InChI=1S/C20H19ClO4/c1-2-24-19(22)12-17-16-8-4-5-13(16)9-10-18(17)25-20(23)14-6-3-7-15(21)11-14/h3,6-7,9-11H,2,4-5,8,12H2,1H3.
What are the key properties of [4-(2-ethoxy-2-oxoethyl)-2,3-dihydro-1H-inden-5-yl] 3-chlorobenzoate?
[4-(2-ethoxy-2-oxoethyl)-2,3-dihydro-1H-inden-5-yl] 3-chlorobenzoate has a molecular weight of 358.82 g/mol, XLogP of 4.15, 5 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for [4-(2-ethoxy-2-oxoethyl)-2,3-dihydro-1H-inden-5-yl] 3-chlorobenzoate is sourced from PubChem (CID 90023548), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).