C20H19ClO4 — CID 90023548
[4-(2-ethoxy-2-oxoethyl)-2,3-dihydro-1H-inden-5-yl] 3-chlorobenzoate (PubChem CID 90023548) has the molecular formula C20H19ClO4 and a molecular weight of 358.82 g/mol. Its IUPAC name is [4-(2-ethoxy-2-oxoethyl)-2,3-dihydro-1H-inden-5-yl] 3-chlorobenzoate.
| Compound Name | [4-(2-ethoxy-2-oxoethyl)-2,3-dihydro-1H-inden-5-yl] 3-chlorobenzoate |
|---|---|
| PubChem CID | 90023548 |
| Molecular Formula | C20H19ClO4 |
| Molecular Weight | 358.82 g/mol |
| Exact Mass | 358.10 |
| IUPAC Name | [4-(2-ethoxy-2-oxoethyl)-2,3-dihydro-1H-inden-5-yl] 3-chlorobenzoate |
| SMILES | CCOC(=O)Cc1c(OC(=O)c2cccc(Cl)c2)ccc2c1CCC2 |
| InChI | InChI=1S/C20H19ClO4/c1-2-24-19(22)12-17-16-8-4-5-13(16)9-10-18(17)25-20(23)14-6-3-7-15(21)11-14/h3,6-7,9-11H,2,4-5,8,12H2,1H3 |
| InChIKey | OSPLOWLHJFXDOH-UHFFFAOYSA-N |
| XLogP | 4.15 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 358.82 |
| LogP ≤ 5 | 4.15 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|