C21H21N3O4 — CID 90024905
[3-(benzylamino)-2,4-dicyano-6-methoxyphenyl] tert-butyl carbonate (PubChem CID 90024905) has the molecular formula C21H21N3O4 and a molecular weight of 379.42 g/mol. Its IUPAC name is [3-(benzylamino)-2,4-dicyano-6-methoxyphenyl] tert-butyl carbonate.
| Compound Name | [3-(benzylamino)-2,4-dicyano-6-methoxyphenyl] tert-butyl carbonate |
|---|---|
| PubChem CID | 90024905 |
| Molecular Formula | C21H21N3O4 |
| Molecular Weight | 379.42 g/mol |
| Exact Mass | 379.15 |
| IUPAC Name | [3-(benzylamino)-2,4-dicyano-6-methoxyphenyl] tert-butyl carbonate |
| SMILES | COc1cc(C#N)c(NCc2ccccc2)c(C#N)c1OC(=O)OC(C)(C)C |
| InChI | InChI=1S/C21H21N3O4/c1-21(2,3)28-20(25)27-19-16(12-23)18(15(11-22)10-17(19)26-4)24-13-14-8-6-5-7-9-14/h5-10,24H,13H2,1-4H3 |
| InChIKey | CLPBSHXEMDEMPR-UHFFFAOYSA-N |
| XLogP | 4.36 |
| TPSA | 104.37 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 379.42 |
| LogP ≤ 5 | 4.36 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'anil_di_alk_C(246)', 'substructure': 'N/A'}, {'alert_name': 'phenyl_carbonate', 'substructure': 'N/A'} |
|---|