C23H26N2O — CID 90026443
2,2,3-trimethyl-3-[4-(naphthalen-2-ylamino)phenyl]butanamide (PubChem CID 90026443) has the molecular formula C23H26N2O and a molecular weight of 346.47 g/mol. Its IUPAC name is 2,2,3-trimethyl-3-[4-(naphthalen-2-ylamino)phenyl]butanamide.
| Compound Name | 2,2,3-trimethyl-3-[4-(naphthalen-2-ylamino)phenyl]butanamide |
|---|---|
| PubChem CID | 90026443 |
| Molecular Formula | C23H26N2O |
| Molecular Weight | 346.47 g/mol |
| Exact Mass | 346.20 |
| IUPAC Name | 2,2,3-trimethyl-3-[4-(naphthalen-2-ylamino)phenyl]butanamide |
| SMILES | CC(C)(C(N)=O)C(C)(C)c1ccc(Nc2ccc3ccccc3c2)cc1 |
| InChI | InChI=1S/C23H26N2O/c1-22(2,23(3,4)21(24)26)18-10-13-19(14-11-18)25-20-12-9-16-7-5-6-8-17(16)15-20/h5-15,25H,1-4H3,(H2,24,26) |
| InChIKey | AXIGYSNAMOZCTK-UHFFFAOYSA-N |
| XLogP | 5.37 |
| TPSA | 55.12 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 346.47 |
| LogP ≤ 5 | 5.37 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |