C19H19NO — CID 19044653
N-anthracen-2-yl-2,2-dimethylpropanamide (PubChem CID 19044653) has the molecular formula C19H19NO and a molecular weight of 277.37 g/mol. Its IUPAC name is N-anthracen-2-yl-2,2-dimethylpropanamide.
| Compound Name | N-anthracen-2-yl-2,2-dimethylpropanamide |
|---|---|
| PubChem CID | 19044653 |
| Molecular Formula | C19H19NO |
| Molecular Weight | 277.37 g/mol |
| Exact Mass | 277.15 |
| IUPAC Name | N-anthracen-2-yl-2,2-dimethylpropanamide |
| SMILES | CC(C)(C)C(=O)Nc1ccc2cc3ccccc3cc2c1 |
| InChI | InChI=1S/C19H19NO/c1-19(2,3)18(21)20-17-9-8-15-10-13-6-4-5-7-14(13)11-16(15)12-17/h4-12H,1-3H3,(H,20,21) |
| InChIKey | BRXFVYZDVQMTOX-UHFFFAOYSA-N |
| XLogP | 4.98 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 277.37 |
| LogP ≤ 5 | 4.98 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'} |
|---|