C11H15NOS2 — CID 101498961
N-[3,4-bis(sulfanyl)phenyl]-2,2-dimethylpropanamide (PubChem CID 101498961) has the molecular formula C11H15NOS2 and a molecular weight of 241.38 g/mol. Its IUPAC name is N-[3,4-bis(sulfanyl)phenyl]-2,2-dimethylpropanamide.
| Compound Name | N-[3,4-bis(sulfanyl)phenyl]-2,2-dimethylpropanamide |
|---|---|
| PubChem CID | 101498961 |
| Molecular Formula | C11H15NOS2 |
| Molecular Weight | 241.38 g/mol |
| Exact Mass | 241.06 |
| IUPAC Name | N-[3,4-bis(sulfanyl)phenyl]-2,2-dimethylpropanamide |
| SMILES | CC(C)(C)C(=O)Nc1ccc(S)c(S)c1 |
| InChI | InChI=1S/C11H15NOS2/c1-11(2,3)10(13)12-7-4-5-8(14)9(15)6-7/h4-6,14-15H,1-3H3,(H,12,13) |
| InChIKey | CNWVQUFNTDRABG-UHFFFAOYSA-N |
| XLogP | 3.25 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 241.38 |
| LogP ≤ 5 | 3.25 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|