C20H22BrF3O — CID 90027600
7-(2-bromoethyl)-2-(4-methylcyclohexyl)oxy-1-(trifluoromethyl)naphthalene (PubChem CID 90027600) has the molecular formula C20H22BrF3O and a molecular weight of 415.29 g/mol. Its IUPAC name is 7-(2-bromoethyl)-2-(4-methylcyclohexyl)oxy-1-(trifluoromethyl)naphthalene.
| Compound Name | 7-(2-bromoethyl)-2-(4-methylcyclohexyl)oxy-1-(trifluoromethyl)naphthalene |
|---|---|
| PubChem CID | 90027600 |
| Molecular Formula | C20H22BrF3O |
| Molecular Weight | 415.29 g/mol |
| Exact Mass | 414.08 |
| IUPAC Name | 7-(2-bromoethyl)-2-(4-methylcyclohexyl)oxy-1-(trifluoromethyl)naphthalene |
| SMILES | CC1CCC(Oc2ccc3ccc(CCBr)cc3c2C(F)(F)F)CC1 |
| InChI | InChI=1S/C20H22BrF3O/c1-13-2-7-16(8-3-13)25-18-9-6-15-5-4-14(10-11-21)12-17(15)19(18)20(22,23)24/h4-6,9,12-13,16H,2-3,7-8,10-11H2,1H3 |
| InChIKey | FGXIBGTZNXWNOW-UHFFFAOYSA-N |
| XLogP | 6.75 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 415.29 |
| LogP ≤ 5 | 6.75 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|