C19H18F6O2 — CID 90028445
[8-(trifluoromethyl)-7-[4-(trifluoromethyl)cyclohexyl]oxynaphthalen-2-yl]methanol (PubChem CID 90028445) has the molecular formula C19H18F6O2 and a molecular weight of 392.34 g/mol. Its IUPAC name is [8-(trifluoromethyl)-7-[4-(trifluoromethyl)cyclohexyl]oxynaphthalen-2-yl]methanol.
| Compound Name | [8-(trifluoromethyl)-7-[4-(trifluoromethyl)cyclohexyl]oxynaphthalen-2-yl]methanol |
|---|---|
| PubChem CID | 90028445 |
| Molecular Formula | C19H18F6O2 |
| Molecular Weight | 392.34 g/mol |
| Exact Mass | 392.12 |
| IUPAC Name | [8-(trifluoromethyl)-7-[4-(trifluoromethyl)cyclohexyl]oxynaphthalen-2-yl]methanol |
| SMILES | OCc1ccc2ccc(OC3CCC(C(F)(F)F)CC3)c(C(F)(F)F)c2c1 |
| InChI | InChI=1S/C19H18F6O2/c20-18(21,22)13-4-6-14(7-5-13)27-16-8-3-12-2-1-11(10-26)9-15(12)17(16)19(23,24)25/h1-3,8-9,13-14,26H,4-7,10H2 |
| InChIKey | GLZQSIFHZDDTNX-UHFFFAOYSA-N |
| XLogP | 5.85 |
| TPSA | 29.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 392.34 |
| LogP ≤ 5 | 5.85 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |