About 4-[[5-[5-bromo-1-(2,4-dichlorophenyl)pyrazol-4-yl]tetrazol-2-yl]methyl]benzonitrile
4-[[5-[5-bromo-1-(2,4-dichlorophenyl)pyrazol-4-yl]tetrazol-2-yl]methyl]benzonitrile (PubChem CID 90029301) has the molecular formula C18H10BrCl2N7
and a molecular weight of 475.14 g/mol. Its IUPAC name is 4-[[5-[5-bromo-1-(2,4-dichlorophenyl)pyrazol-4-yl]tetrazol-2-yl]methyl]benzonitrile.
Molecular Properties
| Compound Name | 4-[[5-[5-bromo-1-(2,4-dichlorophenyl)pyrazol-4-yl]tetrazol-2-yl]methyl]benzonitrile |
| PubChem CID | 90029301 |
| Molecular Formula | C18H10BrCl2N7 |
| Molecular Weight | 475.14 g/mol |
| Exact Mass | 472.96 |
| IUPAC Name | 4-[[5-[5-bromo-1-(2,4-dichlorophenyl)pyrazol-4-yl]tetrazol-2-yl]methyl]benzonitrile |
| SMILES | N#Cc1ccc(Cn2nnc(-c3cnn(-c4ccc(Cl)cc4Cl)c3Br)n2)cc1 |
| InChI | InChI=1S/C18H10BrCl2N7/c19-17-14(9-23-28(17)16-6-5-13(20)7-15(16)21)18-24-26-27(25-18)10-12-3-1-11(8-22)2-4-12/h1-7,9H,10H2 |
| InChIKey | IFFDYRPSYRVDAP-UHFFFAOYSA-N |
| XLogP | 4.52 |
| TPSA | 85.21 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 475.14 |
| LogP ≤ 5 | 4.52 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
Analyze 4-[[5-[5-bromo-1-(2,4-dichlorophenyl)pyrazol-4-yl]tetrazol-2-yl]methyl]benzonitrile with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-[[5-[5-bromo-1-(2,4-dichlorophenyl)pyrazol-4-yl]tetrazol-2-yl]methyl]benzonitrile?
The IUPAC name of 4-[[5-[5-bromo-1-(2,4-dichlorophenyl)pyrazol-4-yl]tetrazol-2-yl]methyl]benzonitrile (CID 90029301) is 4-[[5-[5-bromo-1-(2,4-dichlorophenyl)pyrazol-4-yl]tetrazol-2-yl]methyl]benzonitrile.
What is the SMILES notation for 4-[[5-[5-bromo-1-(2,4-dichlorophenyl)pyrazol-4-yl]tetrazol-2-yl]methyl]benzonitrile?
The canonical SMILES for 4-[[5-[5-bromo-1-(2,4-dichlorophenyl)pyrazol-4-yl]tetrazol-2-yl]methyl]benzonitrile is N#Cc1ccc(Cn2nnc(-c3cnn(-c4ccc(Cl)cc4Cl)c3Br)n2)cc1.
What is the InChIKey of 4-[[5-[5-bromo-1-(2,4-dichlorophenyl)pyrazol-4-yl]tetrazol-2-yl]methyl]benzonitrile?
The InChIKey is IFFDYRPSYRVDAP-UHFFFAOYSA-N. The full InChI is InChI=1S/C18H10BrCl2N7/c19-17-14(9-23-28(17)16-6-5-13(20)7-15(16)21)18-24-26-27(25-18)10-12-3-1-11(8-22)2-4-12/h1-7,9H,10H2.
What are the key properties of 4-[[5-[5-bromo-1-(2,4-dichlorophenyl)pyrazol-4-yl]tetrazol-2-yl]methyl]benzonitrile?
4-[[5-[5-bromo-1-(2,4-dichlorophenyl)pyrazol-4-yl]tetrazol-2-yl]methyl]benzonitrile has a molecular weight of 475.14 g/mol, XLogP of 4.52, 4 rotatable bonds, 0 hydrogen bond donors, and 7 hydrogen bond acceptors.
Where does this data come from?
All data for 4-[[5-[5-bromo-1-(2,4-dichlorophenyl)pyrazol-4-yl]tetrazol-2-yl]methyl]benzonitrile is sourced from PubChem (CID 90029301), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).