C25H18FN7S — CID 90034220
4-[[5-[5-benzylsulfanyl-1-(2-fluorophenyl)pyrazol-4-yl]tetrazol-2-yl]methyl]benzonitrile (PubChem CID 90034220) has the molecular formula C25H18FN7S and a molecular weight of 467.53 g/mol. Its IUPAC name is 4-[[5-[5-benzylsulfanyl-1-(2-fluorophenyl)pyrazol-4-yl]tetrazol-2-yl]methyl]benzonitrile.
| Compound Name | 4-[[5-[5-benzylsulfanyl-1-(2-fluorophenyl)pyrazol-4-yl]tetrazol-2-yl]methyl]benzonitrile |
|---|---|
| PubChem CID | 90034220 |
| Molecular Formula | C25H18FN7S |
| Molecular Weight | 467.53 g/mol |
| Exact Mass | 467.13 |
| IUPAC Name | 4-[[5-[5-benzylsulfanyl-1-(2-fluorophenyl)pyrazol-4-yl]tetrazol-2-yl]methyl]benzonitrile |
| SMILES | N#Cc1ccc(Cn2nnc(-c3cnn(-c4ccccc4F)c3SCc3ccccc3)n2)cc1 |
| InChI | InChI=1S/C25H18FN7S/c26-22-8-4-5-9-23(22)33-25(34-17-20-6-2-1-3-7-20)21(15-28-33)24-29-31-32(30-24)16-19-12-10-18(14-27)11-13-19/h1-13,15H,16-17H2 |
| InChIKey | OZRBZQHSZBFPTF-UHFFFAOYSA-N |
| XLogP | 4.88 |
| TPSA | 85.21 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 467.53 |
| LogP ≤ 5 | 4.88 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |