C22H23N7O2S — CID 90033907
5-[5-benzylsulfanyl-1-(2-methylpropyl)pyrazol-4-yl]-2-[(4-nitrophenyl)methyl]tetrazole (PubChem CID 90033907) has the molecular formula C22H23N7O2S and a molecular weight of 449.54 g/mol. Its IUPAC name is 5-[5-benzylsulfanyl-1-(2-methylpropyl)pyrazol-4-yl]-2-[(4-nitrophenyl)methyl]tetrazole.
| Compound Name | 5-[5-benzylsulfanyl-1-(2-methylpropyl)pyrazol-4-yl]-2-[(4-nitrophenyl)methyl]tetrazole |
|---|---|
| PubChem CID | 90033907 |
| Molecular Formula | C22H23N7O2S |
| Molecular Weight | 449.54 g/mol |
| Exact Mass | 449.16 |
| IUPAC Name | 5-[5-benzylsulfanyl-1-(2-methylpropyl)pyrazol-4-yl]-2-[(4-nitrophenyl)methyl]tetrazole |
| SMILES | CC(C)Cn1ncc(-c2nnn(Cc3ccc([N+](=O)[O-])cc3)n2)c1SCc1ccccc1 |
| InChI | InChI=1S/C22H23N7O2S/c1-16(2)13-27-22(32-15-18-6-4-3-5-7-18)20(12-23-27)21-24-26-28(25-21)14-17-8-10-19(11-9-17)29(30)31/h3-12,16H,13-15H2,1-2H3 |
| InChIKey | KTTWJZFKDKCNDO-UHFFFAOYSA-N |
| XLogP | 4.44 |
| TPSA | 104.56 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 449.54 |
| LogP ≤ 5 | 4.44 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|