About 5-[5-benzylsulfanyl-1-(3,5-dichlorophenyl)pyrazol-4-yl]-2-propan-2-yltetrazole
5-[5-benzylsulfanyl-1-(3,5-dichlorophenyl)pyrazol-4-yl]-2-propan-2-yltetrazole (PubChem CID 90029956) has the molecular formula C20H18Cl2N6S
and a molecular weight of 445.38 g/mol. Its IUPAC name is 5-[5-benzylsulfanyl-1-(3,5-dichlorophenyl)pyrazol-4-yl]-2-propan-2-yltetrazole.
Molecular Properties
| Compound Name | 5-[5-benzylsulfanyl-1-(3,5-dichlorophenyl)pyrazol-4-yl]-2-propan-2-yltetrazole |
| PubChem CID | 90029956 |
| Molecular Formula | C20H18Cl2N6S |
| Molecular Weight | 445.38 g/mol |
| Exact Mass | 444.07 |
| IUPAC Name | 5-[5-benzylsulfanyl-1-(3,5-dichlorophenyl)pyrazol-4-yl]-2-propan-2-yltetrazole |
| SMILES | CC(C)n1nnc(-c2cnn(-c3cc(Cl)cc(Cl)c3)c2SCc2ccccc2)n1 |
| InChI | InChI=1S/C20H18Cl2N6S/c1-13(2)28-25-19(24-26-28)18-11-23-27(17-9-15(21)8-16(22)10-17)20(18)29-12-14-6-4-3-5-7-14/h3-11,13H,12H2,1-2H3 |
| InChIKey | QFLZNGCDYHYDMT-UHFFFAOYSA-N |
| XLogP | 5.71 |
| TPSA | 61.42 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 445.38 |
| LogP ≤ 5 | 5.71 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
Analyze 5-[5-benzylsulfanyl-1-(3,5-dichlorophenyl)pyrazol-4-yl]-2-propan-2-yltetrazole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-[5-benzylsulfanyl-1-(3,5-dichlorophenyl)pyrazol-4-yl]-2-propan-2-yltetrazole?
The IUPAC name of 5-[5-benzylsulfanyl-1-(3,5-dichlorophenyl)pyrazol-4-yl]-2-propan-2-yltetrazole (CID 90029956) is 5-[5-benzylsulfanyl-1-(3,5-dichlorophenyl)pyrazol-4-yl]-2-propan-2-yltetrazole.
What is the SMILES notation for 5-[5-benzylsulfanyl-1-(3,5-dichlorophenyl)pyrazol-4-yl]-2-propan-2-yltetrazole?
The canonical SMILES for 5-[5-benzylsulfanyl-1-(3,5-dichlorophenyl)pyrazol-4-yl]-2-propan-2-yltetrazole is CC(C)n1nnc(-c2cnn(-c3cc(Cl)cc(Cl)c3)c2SCc2ccccc2)n1.
What is the InChIKey of 5-[5-benzylsulfanyl-1-(3,5-dichlorophenyl)pyrazol-4-yl]-2-propan-2-yltetrazole?
The InChIKey is QFLZNGCDYHYDMT-UHFFFAOYSA-N. The full InChI is InChI=1S/C20H18Cl2N6S/c1-13(2)28-25-19(24-26-28)18-11-23-27(17-9-15(21)8-16(22)10-17)20(18)29-12-14-6-4-3-5-7-14/h3-11,13H,12H2,1-2H3.
What are the key properties of 5-[5-benzylsulfanyl-1-(3,5-dichlorophenyl)pyrazol-4-yl]-2-propan-2-yltetrazole?
5-[5-benzylsulfanyl-1-(3,5-dichlorophenyl)pyrazol-4-yl]-2-propan-2-yltetrazole has a molecular weight of 445.38 g/mol, XLogP of 5.71, 6 rotatable bonds, 0 hydrogen bond donors, and 7 hydrogen bond acceptors.
Where does this data come from?
All data for 5-[5-benzylsulfanyl-1-(3,5-dichlorophenyl)pyrazol-4-yl]-2-propan-2-yltetrazole is sourced from PubChem (CID 90029956), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).