C20H21IN6O — CID 90030538
5-[1-(4-ethylphenyl)-5-iodopyrazol-4-yl]-1-[(4-methoxyphenyl)methyl]-2,3-dihydrotetrazole (PubChem CID 90030538) has the molecular formula C20H21IN6O and a molecular weight of 488.33 g/mol. Its IUPAC name is 5-[1-(4-ethylphenyl)-5-iodopyrazol-4-yl]-1-[(4-methoxyphenyl)methyl]-2,3-dihydrotetrazole.
| Compound Name | 5-[1-(4-ethylphenyl)-5-iodopyrazol-4-yl]-1-[(4-methoxyphenyl)methyl]-2,3-dihydrotetrazole |
|---|---|
| PubChem CID | 90030538 |
| Molecular Formula | C20H21IN6O |
| Molecular Weight | 488.33 g/mol |
| Exact Mass | 488.08 |
| IUPAC Name | 5-[1-(4-ethylphenyl)-5-iodopyrazol-4-yl]-1-[(4-methoxyphenyl)methyl]-2,3-dihydrotetrazole |
| SMILES | CCc1ccc(-n2ncc(C3=NNNN3Cc3ccc(OC)cc3)c2I)cc1 |
| InChI | InChI=1S/C20H21IN6O/c1-3-14-4-8-16(9-5-14)27-19(21)18(12-22-27)20-23-24-25-26(20)13-15-6-10-17(28-2)11-7-15/h4-12,24-25H,3,13H2,1-2H3 |
| InChIKey | XOYRKDLDKHHJEH-UHFFFAOYSA-N |
| XLogP | 3.23 |
| TPSA | 66.71 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 488.33 |
| LogP ≤ 5 | 3.23 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|