C18H16Cl2N6OS — CID 90034148
2-(2,6-dichlorophenyl)-4-[1-[(4-methoxyphenyl)methyl]-2,3-dihydrotetrazol-5-yl]-1H-pyrazole-3-thione (PubChem CID 90034148) has the molecular formula C18H16Cl2N6OS and a molecular weight of 435.34 g/mol. Its IUPAC name is 2-(2,6-dichlorophenyl)-4-[1-[(4-methoxyphenyl)methyl]-2,3-dihydrotetrazol-5-yl]-1H-pyrazole-3-thione.
| Compound Name | 2-(2,6-dichlorophenyl)-4-[1-[(4-methoxyphenyl)methyl]-2,3-dihydrotetrazol-5-yl]-1H-pyrazole-3-thione |
|---|---|
| PubChem CID | 90034148 |
| Molecular Formula | C18H16Cl2N6OS |
| Molecular Weight | 435.34 g/mol |
| Exact Mass | 434.05 |
| IUPAC Name | 2-(2,6-dichlorophenyl)-4-[1-[(4-methoxyphenyl)methyl]-2,3-dihydrotetrazol-5-yl]-1H-pyrazole-3-thione |
| SMILES | COc1ccc(CN2NNN=C2c2c[nH]n(-c3c(Cl)cccc3Cl)c2=S)cc1 |
| InChI | InChI=1S/C18H16Cl2N6OS/c1-27-12-7-5-11(6-8-12)10-25-17(22-23-24-25)13-9-21-26(18(13)28)16-14(19)3-2-4-15(16)20/h2-9,21,23-24H,10H2,1H3 |
| InChIKey | ZFPCLVLFBXLITG-UHFFFAOYSA-N |
| XLogP | 4.04 |
| TPSA | 69.61 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 435.34 |
| LogP ≤ 5 | 4.04 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|