C22H16Cl2N2O4 — CID 11690802
1-(2,6-dichlorophenyl)-6-[(4-methoxyphenyl)methyl]-8H-1,6-naphthyridine-2,5,7-trione (PubChem CID 11690802) has the molecular formula C22H16Cl2N2O4 and a molecular weight of 443.29 g/mol. Its IUPAC name is 1-(2,6-dichlorophenyl)-6-[(4-methoxyphenyl)methyl]-8H-1,6-naphthyridine-2,5,7-trione.
| Compound Name | 1-(2,6-dichlorophenyl)-6-[(4-methoxyphenyl)methyl]-8H-1,6-naphthyridine-2,5,7-trione |
|---|---|
| PubChem CID | 11690802 |
| Molecular Formula | C22H16Cl2N2O4 |
| Molecular Weight | 443.29 g/mol |
| Exact Mass | 442.05 |
| IUPAC Name | 1-(2,6-dichlorophenyl)-6-[(4-methoxyphenyl)methyl]-8H-1,6-naphthyridine-2,5,7-trione |
| SMILES | COc1ccc(CN2C(=O)Cc3c(ccc(=O)n3-c3c(Cl)cccc3Cl)C2=O)cc1 |
| InChI | InChI=1S/C22H16Cl2N2O4/c1-30-14-7-5-13(6-8-14)12-25-20(28)11-18-15(22(25)29)9-10-19(27)26(18)21-16(23)3-2-4-17(21)24/h2-10H,11-12H2,1H3 |
| InChIKey | BZDZRGXMAYZKHJ-UHFFFAOYSA-N |
| XLogP | 3.88 |
| TPSA | 68.61 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 443.29 |
| LogP ≤ 5 | 3.88 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|