C13H9FN2O2S — CID 90030943
ethyl 2-(4-cyano-2-fluorophenyl)-1,3-thiazole-4-carboxylate (PubChem CID 90030943) has the molecular formula C13H9FN2O2S and a molecular weight of 276.29 g/mol. Its IUPAC name is ethyl 2-(4-cyano-2-fluorophenyl)-1,3-thiazole-4-carboxylate.
| Compound Name | ethyl 2-(4-cyano-2-fluorophenyl)-1,3-thiazole-4-carboxylate |
|---|---|
| PubChem CID | 90030943 |
| Molecular Formula | C13H9FN2O2S |
| Molecular Weight | 276.29 g/mol |
| Exact Mass | 276.04 |
| IUPAC Name | ethyl 2-(4-cyano-2-fluorophenyl)-1,3-thiazole-4-carboxylate |
| SMILES | CCOC(=O)c1csc(-c2ccc(C#N)cc2F)n1 |
| InChI | InChI=1S/C13H9FN2O2S/c1-2-18-13(17)11-7-19-12(16-11)9-4-3-8(6-15)5-10(9)14/h3-5,7H,2H2,1H3 |
| InChIKey | SQGBBWYXMDKWDX-UHFFFAOYSA-N |
| XLogP | 3.00 |
| TPSA | 62.98 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 276.29 |
| LogP ≤ 5 | 3.00 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |