About ethyl 9-azatricyclo[4.4.0.02,4]deca-7,9-diene-3-carboxylate
ethyl 9-azatricyclo[4.4.0.02,4]deca-7,9-diene-3-carboxylate (PubChem CID 90032894) has the molecular formula C12H15NO2
and a molecular weight of 205.26 g/mol. Its IUPAC name is ethyl 9-azatricyclo[4.4.0.02,4]deca-7,9-diene-3-carboxylate.
Analyze ethyl 9-azatricyclo[4.4.0.02,4]deca-7,9-diene-3-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethyl 9-azatricyclo[4.4.0.02,4]deca-7,9-diene-3-carboxylate?
The IUPAC name of ethyl 9-azatricyclo[4.4.0.02,4]deca-7,9-diene-3-carboxylate (CID 90032894) is ethyl 9-azatricyclo[4.4.0.02,4]deca-7,9-diene-3-carboxylate.
What is the SMILES notation for ethyl 9-azatricyclo[4.4.0.02,4]deca-7,9-diene-3-carboxylate?
The canonical SMILES for ethyl 9-azatricyclo[4.4.0.02,4]deca-7,9-diene-3-carboxylate is CCOC(=O)C1C2CC3C=CN=CC3C21.
What is the InChIKey of ethyl 9-azatricyclo[4.4.0.02,4]deca-7,9-diene-3-carboxylate?
The InChIKey is NSSDBHLFYMRHQJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H15NO2/c1-2-15-12(14)11-8-5-7-3-4-13-6-9(7)10(8)11/h3-4,6-11H,2,5H2,1H3.
What are the key properties of ethyl 9-azatricyclo[4.4.0.02,4]deca-7,9-diene-3-carboxylate?
ethyl 9-azatricyclo[4.4.0.02,4]deca-7,9-diene-3-carboxylate has a molecular weight of 205.26 g/mol, XLogP of 1.65, 2 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for ethyl 9-azatricyclo[4.4.0.02,4]deca-7,9-diene-3-carboxylate is sourced from PubChem (CID 90032894), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).