C10H13F6NO2 — CID 90037294
ethyl (Z)-3-[[3,3,3-trifluoro-2-(trifluoromethyl)propyl]amino]but-2-enoate (PubChem CID 90037294) has the molecular formula C10H13F6NO2 and a molecular weight of 293.21 g/mol. Its IUPAC name is ethyl (Z)-3-[[3,3,3-trifluoro-2-(trifluoromethyl)propyl]amino]but-2-enoate.
| Compound Name | ethyl (Z)-3-[[3,3,3-trifluoro-2-(trifluoromethyl)propyl]amino]but-2-enoate |
|---|---|
| PubChem CID | 90037294 |
| Molecular Formula | C10H13F6NO2 |
| Molecular Weight | 293.21 g/mol |
| Exact Mass | 293.09 |
| IUPAC Name | ethyl (Z)-3-[[3,3,3-trifluoro-2-(trifluoromethyl)propyl]amino]but-2-enoate |
| SMILES | CCOC(=O)/C=C(/C)NCC(C(F)(F)F)C(F)(F)F |
| InChI | InChI=1S/C10H13F6NO2/c1-3-19-8(18)4-6(2)17-5-7(9(11,12)13)10(14,15)16/h4,7,17H,3,5H2,1-2H3/b6-4- |
| InChIKey | KGYWAZZISFPXPQ-XQRVVYSFSA-N |
| XLogP | 2.78 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 293.21 |
| LogP ≤ 5 | 2.78 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|